C25H26ClN7O4S2 — CID 20799930
1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-pyrrolidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea (PubChem CID 20799930) has the molecular formula C25H26ClN7O4S2 and a molecular weight of 588.12 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-pyrrolidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-pyrrolidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 20799930 |
| Molecular Formula | C25H26ClN7O4S2 |
| Molecular Weight | 588.12 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-pyrrolidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(-n2cnc3cc(NCCCN4CCCC4)ccc3c2=O)nc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C25H26ClN7O4S2/c26-21-7-9-23(38-21)39(36,37)31-25(35)30-18-5-8-22(28-15-18)33-16-29-20-14-17(4-6-19(20)24(33)34)27-10-3-13-32-11-1-2-12-32/h4-9,14-16,27H,1-3,10-13H2,(H2,30,31,35) |
| InChIKey | KLUNFFVJXZBDSQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.12 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|