C26H27ClN6O6S2 — CID 91083029
1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(3-morpholin-4-ylpropylamino)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea (PubChem CID 91083029) has the molecular formula C26H27ClN6O6S2 and a molecular weight of 619.13 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(3-morpholin-4-ylpropylamino)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(3-morpholin-4-ylpropylamino)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 91083029 |
| Molecular Formula | C26H27ClN6O6S2 |
| Molecular Weight | 619.13 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(3-morpholin-4-ylpropylamino)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(-n2c(O)c3ccc(NCCCN4CCOCC4)cc3cc2=O)nc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H27ClN6O6S2/c27-21-5-7-24(40-21)41(37,38)31-26(36)30-19-3-6-22(29-16-19)33-23(34)15-17-14-18(2-4-20(17)25(33)35)28-8-1-9-32-10-12-39-13-11-32/h2-7,14-16,28,35H,1,8-13H2,(H2,30,31,36) |
| InChIKey | CFOUPROLOCAWKQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|