C26H28ClN7O4S2 — CID 20799929
1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea (PubChem CID 20799929) has the molecular formula C26H28ClN7O4S2 and a molecular weight of 602.14 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 20799929 |
| Molecular Formula | C26H28ClN7O4S2 |
| Molecular Weight | 602.14 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[4-oxo-7-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(-n2cnc3cc(NCCCN4CCCCC4)ccc3c2=O)nc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H28ClN7O4S2/c27-22-8-10-24(39-22)40(37,38)32-26(36)31-19-6-9-23(29-16-19)34-17-30-21-15-18(5-7-20(21)25(34)35)28-11-4-14-33-12-2-1-3-13-33/h5-10,15-17,28H,1-4,11-14H2,(H2,31,32,36) |
| InChIKey | PYBKFRLWDAYQEA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.14 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|