C18H12ClN5O4S2 — CID 20799933
1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-(4-oxoquinazolin-3-yl)-3-pyridinyl]urea (PubChem CID 20799933) has the molecular formula C18H12ClN5O4S2 and a molecular weight of 461.91 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-(4-oxoquinazolin-3-yl)-3-pyridinyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-(4-oxoquinazolin-3-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 20799933 |
| Molecular Formula | C18H12ClN5O4S2 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-(4-oxoquinazolin-3-yl)-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(-n2cnc3ccccc3c2=O)nc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H12ClN5O4S2/c19-14-6-8-16(29-14)30(27,28)23-18(26)22-11-5-7-15(20-9-11)24-10-21-13-4-2-1-3-12(13)17(24)25/h1-10H,(H2,22,23,26) |
| InChIKey | UGKQFSYTRLKRIT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |