C19H12BrClN4O4S2 — CID 20799256
1-[4-(6-bromo-4-oxoquinazolin-3-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea (PubChem CID 20799256) has the molecular formula C19H12BrClN4O4S2 and a molecular weight of 539.82 g/mol. Its IUPAC name is 1-[4-(6-bromo-4-oxoquinazolin-3-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[4-(6-bromo-4-oxoquinazolin-3-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20799256 |
| Molecular Formula | C19H12BrClN4O4S2 |
| Molecular Weight | 539.82 g/mol |
| Exact Mass | 537.92 |
| IUPAC Name | 1-[4-(6-bromo-4-oxoquinazolin-3-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea |
| SMILES | O=C(Nc1ccc(-n2cnc3ccc(Br)cc3c2=O)cc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H12BrClN4O4S2/c20-11-1-6-15-14(9-11)18(26)25(10-22-15)13-4-2-12(3-5-13)23-19(27)24-31(28,29)17-8-7-16(21)30-17/h1-10H,(H2,23,24,27) |
| InChIKey | ACJIDHDOQJBREP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |