C20H14ClFIN5O4S2 — CID 67966461
1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-5-iodo-4-[7-(methylamino)-4-oxoquinazolin-3-yl]phenyl]urea (PubChem CID 67966461) has the molecular formula C20H14ClFIN5O4S2 and a molecular weight of 633.85 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-5-iodo-4-[7-(methylamino)-4-oxoquinazolin-3-yl]phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-5-iodo-4-[7-(methylamino)-4-oxoquinazolin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 67966461 |
| Molecular Formula | C20H14ClFIN5O4S2 |
| Molecular Weight | 633.85 g/mol |
| Exact Mass | 632.92 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[3-fluoro-5-iodo-4-[7-(methylamino)-4-oxoquinazolin-3-yl]phenyl]urea |
| SMILES | CNc1ccc2c(=O)n(-c3c(F)cc(NC(=O)NS(=O)(=O)c4ccc(Cl)s4)cc3I)cnc2c1 |
| InChI | InChI=1S/C20H14ClFIN5O4S2/c1-24-10-2-3-12-15(8-10)25-9-28(19(12)29)18-13(22)6-11(7-14(18)23)26-20(30)27-34(31,32)17-5-4-16(21)33-17/h2-9,24H,1H3,(H2,26,27,30) |
| InChIKey | PDJCCHKDAFPIRN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|