C27H28ClN5O6S2 — CID 159397732
3-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-7-(3-morpholin-4-ylpropylamino)-1H-quinazoline-2,4-dione (PubChem CID 159397732) has the molecular formula C27H28ClN5O6S2 and a molecular weight of 618.14 g/mol. Its IUPAC name is 3-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-7-(3-morpholin-4-ylpropylamino)-1H-quinazoline-2,4-dione.
| Compound Name | 3-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-7-(3-morpholin-4-ylpropylamino)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 159397732 |
| Molecular Formula | C27H28ClN5O6S2 |
| Molecular Weight | 618.14 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | 3-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-7-(3-morpholin-4-ylpropylamino)-1H-quinazoline-2,4-dione |
| SMILES | O=C(Cc1ccc(-n2c(=O)[nH]c3cc(NCCCN4CCOCC4)ccc3c2=O)nc1)CS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C27H28ClN5O6S2/c28-23-5-7-25(40-23)41(37,38)17-20(34)14-18-2-6-24(30-16-18)33-26(35)21-4-3-19(15-22(21)31-27(33)36)29-8-1-9-32-10-12-39-13-11-32/h2-7,15-16,29H,1,8-14,17H2,(H,31,36) |
| InChIKey | OVPQRACVHQBPOM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|