C29H32N4O4S2 — CID 159018288
2-[5-[3-(5-methylthiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-pyrrolidin-1-ylpropylamino)isoquinolin-1-one (PubChem CID 159018288) has the molecular formula C29H32N4O4S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-[5-[3-(5-methylthiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-pyrrolidin-1-ylpropylamino)isoquinolin-1-one.
| Compound Name | 2-[5-[3-(5-methylthiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-pyrrolidin-1-ylpropylamino)isoquinolin-1-one |
|---|---|
| PubChem CID | 159018288 |
| Molecular Formula | C29H32N4O4S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 2-[5-[3-(5-methylthiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-pyrrolidin-1-ylpropylamino)isoquinolin-1-one |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)Cc2ccc(-n3ccc4cc(NCCCN5CCCC5)ccc4c3=O)nc2)s1 |
| InChI | InChI=1S/C29H32N4O4S2/c1-21-5-10-28(38-21)39(36,37)20-25(34)17-22-6-9-27(31-19-22)33-16-11-23-18-24(7-8-26(23)29(33)35)30-12-4-15-32-13-2-3-14-32/h5-11,16,18-19,30H,2-4,12-15,17,20H2,1H3 |
| InChIKey | VEFDCMFMBVTTNZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|