C28H29ClN4O5S2 — CID 157416669
3-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-7-(3-pyrrolidin-1-ylpropylamino)-1H-quinazoline-2,4-dione (PubChem CID 157416669) has the molecular formula C28H29ClN4O5S2 and a molecular weight of 601.15 g/mol. Its IUPAC name is 3-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-7-(3-pyrrolidin-1-ylpropylamino)-1H-quinazoline-2,4-dione.
| Compound Name | 3-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-7-(3-pyrrolidin-1-ylpropylamino)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 157416669 |
| Molecular Formula | C28H29ClN4O5S2 |
| Molecular Weight | 601.15 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 3-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-7-(3-pyrrolidin-1-ylpropylamino)-1H-quinazoline-2,4-dione |
| SMILES | O=C(Cc1ccc(-n2c(=O)[nH]c3cc(NCCCN4CCCC4)ccc3c2=O)cc1)CS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C28H29ClN4O5S2/c29-25-10-11-26(39-25)40(37,38)18-22(34)16-19-4-7-21(8-5-19)33-27(35)23-9-6-20(17-24(23)31-28(33)36)30-12-3-15-32-13-1-2-14-32/h4-11,17,30H,1-3,12-16,18H2,(H,31,36) |
| InChIKey | UTVJGVMVVFYFDK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.15 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|