C29H29ClFN3O5S2 — CID 159442001
2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-fluorophenyl]-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione (PubChem CID 159442001) has the molecular formula C29H29ClFN3O5S2 and a molecular weight of 618.15 g/mol. Its IUPAC name is 2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-fluorophenyl]-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione.
| Compound Name | 2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-fluorophenyl]-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 159442001 |
| Molecular Formula | C29H29ClFN3O5S2 |
| Molecular Weight | 618.15 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | 2-[4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-fluorophenyl]-6-(3-pyrrolidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione |
| SMILES | O=C(Cc1ccc(N2C(=O)Cc3cc(NCCCN4CCCC4)ccc3C2=O)c(F)c1)CS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C29H29ClFN3O5S2/c30-26-8-9-28(40-26)41(38,39)18-22(35)14-19-4-7-25(24(31)15-19)34-27(36)17-20-16-21(5-6-23(20)29(34)37)32-10-3-13-33-11-1-2-12-33/h4-9,15-16,32H,1-3,10-14,17-18H2 |
| InChIKey | SXAMNSXDGDZXSN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|