C28H30ClN5O5S2 — CID 20799660
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea (PubChem CID 20799660) has the molecular formula C28H30ClN5O5S2 and a molecular weight of 616.17 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 20799660 |
| Molecular Formula | C28H30ClN5O5S2 |
| Molecular Weight | 616.17 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3cc(NCCCN4CCCCC4)ccc3C2=O)cc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C28H30ClN5O5S2/c29-24-11-12-26(40-24)41(38,39)32-28(37)31-20-5-8-22(9-6-20)34-25(35)18-19-17-21(7-10-23(19)27(34)36)30-13-4-16-33-14-2-1-3-15-33/h5-12,17,30H,1-4,13-16,18H2,(H2,31,32,37) |
| InChIKey | WXXQJOLKNGPWJQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.17 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|