C20H14ClN3O5S2 — CID 20799652
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea (PubChem CID 20799652) has the molecular formula C20H14ClN3O5S2 and a molecular weight of 475.94 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 20799652 |
| Molecular Formula | C20H14ClN3O5S2 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3ccccc3C2=O)cc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H14ClN3O5S2/c21-16-9-10-18(30-16)31(28,29)23-20(27)22-13-5-7-14(8-6-13)24-17(25)11-12-3-1-2-4-15(12)19(24)26/h1-10H,11H2,(H2,22,23,27) |
| InChIKey | VIZNTSKUZJUTIX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|