C22H16ClF3N4O5S2 — CID 20799656
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(2,2,2-trifluoroethylamino)-4H-isoquinolin-2-yl]phenyl]urea (PubChem CID 20799656) has the molecular formula C22H16ClF3N4O5S2 and a molecular weight of 572.97 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(2,2,2-trifluoroethylamino)-4H-isoquinolin-2-yl]phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(2,2,2-trifluoroethylamino)-4H-isoquinolin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 20799656 |
| Molecular Formula | C22H16ClF3N4O5S2 |
| Molecular Weight | 572.97 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[1,3-dioxo-6-(2,2,2-trifluoroethylamino)-4H-isoquinolin-2-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3cc(NCC(F)(F)F)ccc3C2=O)cc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H16ClF3N4O5S2/c23-17-7-8-19(36-17)37(34,35)29-21(33)28-13-1-4-15(5-2-13)30-18(31)10-12-9-14(27-11-22(24,25)26)3-6-16(12)20(30)32/h1-9,27H,10-11H2,(H2,28,29,33) |
| InChIKey | LVFFBXXTMSSZBN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|