C21H16ClN3O7S3 — CID 67966427
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(7-methylsulfonyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea (PubChem CID 67966427) has the molecular formula C21H16ClN3O7S3 and a molecular weight of 554.03 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(7-methylsulfonyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(7-methylsulfonyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 67966427 |
| Molecular Formula | C21H16ClN3O7S3 |
| Molecular Weight | 554.03 g/mol |
| Exact Mass | 552.98 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(7-methylsulfonyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C(=O)N(c1ccc(NC(=O)NS(=O)(=O)c3ccc(Cl)s3)cc1)C(=O)C2 |
| InChI | InChI=1S/C21H16ClN3O7S3/c1-34(29,30)15-7-2-12-10-18(26)25(20(27)16(12)11-15)14-5-3-13(4-6-14)23-21(28)24-35(31,32)19-9-8-17(22)33-19/h2-9,11H,10H2,1H3,(H2,23,24,28) |
| InChIKey | ZFRBNJQWYKCMGQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.03 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|