C23H19ClN4O5S2 — CID 20800181
1-(4-chloro-5-methylthiophen-2-yl)sulfonyl-3-[4-(6,8-dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)phenyl]urea (PubChem CID 20800181) has the molecular formula C23H19ClN4O5S2 and a molecular weight of 531.02 g/mol. Its IUPAC name is 1-(4-chloro-5-methylthiophen-2-yl)sulfonyl-3-[4-(6,8-dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)phenyl]urea.
| Compound Name | 1-(4-chloro-5-methylthiophen-2-yl)sulfonyl-3-[4-(6,8-dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)phenyl]urea |
|---|---|
| PubChem CID | 20800181 |
| Molecular Formula | C23H19ClN4O5S2 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 1-(4-chloro-5-methylthiophen-2-yl)sulfonyl-3-[4-(6,8-dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)phenyl]urea |
| SMILES | Cc1sc(S(=O)(=O)NC(=O)Nc2ccc(N3C(=O)Cc4c(ccc5c4CCN5)C3=O)cc2)cc1Cl |
| InChI | InChI=1S/C23H19ClN4O5S2/c1-12-18(24)11-21(34-12)35(32,33)27-23(31)26-13-2-4-14(5-3-13)28-20(29)10-17-15-8-9-25-19(15)7-6-16(17)22(28)30/h2-7,11,25H,8-10H2,1H3,(H2,26,27,31) |
| InChIKey | ZKQYPLCAVKPYPA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|