C20H13Cl2N3O5S2 — CID 20799070
1-[3-chloro-4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea (PubChem CID 20799070) has the molecular formula C20H13Cl2N3O5S2 and a molecular weight of 510.38 g/mol. Its IUPAC name is 1-[3-chloro-4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[3-chloro-4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20799070 |
| Molecular Formula | C20H13Cl2N3O5S2 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | 1-[3-chloro-4-(1,3-dioxo-4H-isoquinolin-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3ccccc3C2=O)c(Cl)c1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H13Cl2N3O5S2/c21-14-10-12(23-20(28)24-32(29,30)18-8-7-16(22)31-18)5-6-15(14)25-17(26)9-11-3-1-2-4-13(11)19(25)27/h1-8,10H,9H2,(H2,23,24,28) |
| InChIKey | FOLVTXXNWUJLHE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|