C20H12Cl2N2O4S2 — CID 20799090
1-[3-chloro-4-(1-oxoinden-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea (PubChem CID 20799090) has the molecular formula C20H12Cl2N2O4S2 and a molecular weight of 479.37 g/mol. Its IUPAC name is 1-[3-chloro-4-(1-oxoinden-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[3-chloro-4-(1-oxoinden-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20799090 |
| Molecular Formula | C20H12Cl2N2O4S2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | 1-[3-chloro-4-(1-oxoinden-2-yl)phenyl]-3-(5-chlorothiophen-2-yl)sulfonylurea |
| SMILES | O=C(Nc1ccc(C2=Cc3ccccc3C2=O)c(Cl)c1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H12Cl2N2O4S2/c21-16-10-12(23-20(26)24-30(27,28)18-8-7-17(22)29-18)5-6-14(16)15-9-11-3-1-2-4-13(11)19(15)25/h1-10H,(H2,23,24,26) |
| InChIKey | FQWRTHQTVVFVAX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|