C22H14Cl3NO5S2 — CID 159676723
7-chloro-2-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione (PubChem CID 159676723) has the molecular formula C22H14Cl3NO5S2 and a molecular weight of 542.85 g/mol. Its IUPAC name is 7-chloro-2-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 7-chloro-2-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 159676723 |
| Molecular Formula | C22H14Cl3NO5S2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 540.94 |
| IUPAC Name | 7-chloro-2-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-4H-isoquinoline-1,3-dione |
| SMILES | O=C(Cc1ccc(N2C(=O)Cc3ccc(Cl)cc3C2=O)c(Cl)c1)CS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H14Cl3NO5S2/c23-14-3-2-13-9-20(28)26(22(29)16(13)10-14)18-4-1-12(8-17(18)24)7-15(27)11-33(30,31)21-6-5-19(25)32-21/h1-6,8,10H,7,9,11H2 |
| InChIKey | BFRJNUVHEKUCPM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|