C22H17FN2O7S3 — CID 161384652
2-[2-fluoro-4-(2-oxo-3-thiophen-2-ylsulfonylpropyl)phenyl]-1,3-dioxo-7-(sulfinoamino)-4H-isoquinoline (PubChem CID 161384652) has the molecular formula C22H17FN2O7S3 and a molecular weight of 536.58 g/mol. Its IUPAC name is 2-[2-fluoro-4-(2-oxo-3-thiophen-2-ylsulfonylpropyl)phenyl]-1,3-dioxo-7-(sulfinoamino)-4H-isoquinoline.
| Compound Name | 2-[2-fluoro-4-(2-oxo-3-thiophen-2-ylsulfonylpropyl)phenyl]-1,3-dioxo-7-(sulfinoamino)-4H-isoquinoline |
|---|---|
| PubChem CID | 161384652 |
| Molecular Formula | C22H17FN2O7S3 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-[2-fluoro-4-(2-oxo-3-thiophen-2-ylsulfonylpropyl)phenyl]-1,3-dioxo-7-(sulfinoamino)-4H-isoquinoline |
| SMILES | O=C(Cc1ccc(N2C(=O)Cc3ccc(NS(=O)O)cc3C2=O)c(F)c1)CS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H17FN2O7S3/c23-18-9-13(8-16(26)12-35(31,32)21-2-1-7-33-21)3-6-19(18)25-20(27)10-14-4-5-15(24-34(29)30)11-17(14)22(25)28/h1-7,9,11,24H,8,10,12H2,(H,29,30) |
| InChIKey | VSXHHDIZXAJUFZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|