C21H16BrFN4O5S2 — CID 20799297
1-[4-[7-bromo-6-(methylamino)-1,3-dioxo-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-thiophen-2-ylsulfonylurea (PubChem CID 20799297) has the molecular formula C21H16BrFN4O5S2 and a molecular weight of 567.42 g/mol. Its IUPAC name is 1-[4-[7-bromo-6-(methylamino)-1,3-dioxo-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-thiophen-2-ylsulfonylurea.
| Compound Name | 1-[4-[7-bromo-6-(methylamino)-1,3-dioxo-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-thiophen-2-ylsulfonylurea |
|---|---|
| PubChem CID | 20799297 |
| Molecular Formula | C21H16BrFN4O5S2 |
| Molecular Weight | 567.42 g/mol |
| Exact Mass | 565.97 |
| IUPAC Name | 1-[4-[7-bromo-6-(methylamino)-1,3-dioxo-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-thiophen-2-ylsulfonylurea |
| SMILES | CNc1cc2c(cc1Br)C(=O)N(c1ccc(NC(=O)NS(=O)(=O)c3cccs3)cc1F)C(=O)C2 |
| InChI | InChI=1S/C21H16BrFN4O5S2/c1-24-16-7-11-8-18(28)27(20(29)13(11)10-14(16)22)17-5-4-12(9-15(17)23)25-21(30)26-34(31,32)19-3-2-6-33-19/h2-7,9-10,24H,8H2,1H3,(H2,25,26,30) |
| InChIKey | JPVQUTNTFAWOPG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|