C22H18FN5O5S2 — CID 90956328
1-[3-fluoro-4-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]phenyl]-3-thiophen-2-ylsulfonylurea (PubChem CID 90956328) has the molecular formula C22H18FN5O5S2 and a molecular weight of 515.55 g/mol. Its IUPAC name is 1-[3-fluoro-4-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]phenyl]-3-thiophen-2-ylsulfonylurea.
| Compound Name | 1-[3-fluoro-4-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]phenyl]-3-thiophen-2-ylsulfonylurea |
|---|---|
| PubChem CID | 90956328 |
| Molecular Formula | C22H18FN5O5S2 |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 1-[3-fluoro-4-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]phenyl]-3-thiophen-2-ylsulfonylurea |
| SMILES | C/N=C(\N)c1ccc2c(O)n(-c3ccc(NC(=O)NS(=O)(=O)c4cccs4)cc3F)c(=O)cc2c1 |
| InChI | InChI=1S/C22H18FN5O5S2/c1-25-20(24)12-4-6-15-13(9-12)10-18(29)28(21(15)30)17-7-5-14(11-16(17)23)26-22(31)27-35(32,33)19-3-2-8-34-19/h2-11,30H,1H3,(H2,24,25)(H2,26,27,31) |
| InChIKey | YCXGWPDQWPCYEJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 155.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|