C21H17FN6O5S2 — CID 91440508
1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea (PubChem CID 91440508) has the molecular formula C21H17FN6O5S2 and a molecular weight of 516.54 g/mol. Its IUPAC name is 1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea.
| Compound Name | 1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 91440508 |
| Molecular Formula | C21H17FN6O5S2 |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[1-hydroxy-6-(N'-methylcarbamimidoyl)-3-oxoisoquinolin-2-yl]-3-pyridinyl]urea |
| SMILES | C/N=C(\N)c1ccc2c(O)n(-c3ccc(NC(=O)NS(=O)(=O)c4ccc(F)s4)cn3)c(=O)cc2c1 |
| InChI | InChI=1S/C21H17FN6O5S2/c1-24-19(23)11-2-4-14-12(8-11)9-17(29)28(20(14)30)16-6-3-13(10-25-16)26-21(31)27-35(32,33)18-7-5-15(22)34-18/h2-10,30H,1H3,(H2,23,24)(H2,26,27,31) |
| InChIKey | MZTOKBNUKCPHLM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|