C20H15FN6O6S2 — CID 20800025
1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[6-(methylamino)-4-nitro-1-oxoisoquinolin-2-yl]-3-pyridinyl]urea (PubChem CID 20800025) has the molecular formula C20H15FN6O6S2 and a molecular weight of 518.51 g/mol. Its IUPAC name is 1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[6-(methylamino)-4-nitro-1-oxoisoquinolin-2-yl]-3-pyridinyl]urea.
| Compound Name | 1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[6-(methylamino)-4-nitro-1-oxoisoquinolin-2-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 20800025 |
| Molecular Formula | C20H15FN6O6S2 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 1-(5-fluorothiophen-2-yl)sulfonyl-3-[6-[6-(methylamino)-4-nitro-1-oxoisoquinolin-2-yl]-3-pyridinyl]urea |
| SMILES | CNc1ccc2c(=O)n(-c3ccc(NC(=O)NS(=O)(=O)c4ccc(F)s4)cn3)cc([N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C20H15FN6O6S2/c1-22-11-2-4-13-14(8-11)15(27(30)31)10-26(19(13)28)17-6-3-12(9-23-17)24-20(29)25-35(32,33)18-7-5-16(21)34-18/h2-10,22H,1H3,(H2,24,25,29) |
| InChIKey | LUMZMJZDEMPRCW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|