C29H32FN5O5S2 — CID 67966390
1-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea (PubChem CID 67966390) has the molecular formula C29H32FN5O5S2 and a molecular weight of 613.74 g/mol. Its IUPAC name is 1-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea.
| Compound Name | 1-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 67966390 |
| Molecular Formula | C29H32FN5O5S2 |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 1-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(N3C(=O)Cc4cc(NCCCN5CCCCC5)ccc4C3=O)c(F)c2)s1 |
| InChI | InChI=1S/C29H32FN5O5S2/c1-19-6-11-27(41-19)42(39,40)33-29(38)32-22-8-10-25(24(30)18-22)35-26(36)17-20-16-21(7-9-23(20)28(35)37)31-12-5-15-34-13-3-2-4-14-34/h6-11,16,18,31H,2-5,12-15,17H2,1H3,(H2,32,33,38) |
| InChIKey | KSSLKRPRIZPFDP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|