C29H32ClN5O3S2 — CID 142210246
1-(4-chloro-5-methylthiophen-2-yl)sulfanyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea (PubChem CID 142210246) has the molecular formula C29H32ClN5O3S2 and a molecular weight of 598.19 g/mol. Its IUPAC name is 1-(4-chloro-5-methylthiophen-2-yl)sulfanyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea.
| Compound Name | 1-(4-chloro-5-methylthiophen-2-yl)sulfanyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 142210246 |
| Molecular Formula | C29H32ClN5O3S2 |
| Molecular Weight | 598.19 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | 1-(4-chloro-5-methylthiophen-2-yl)sulfanyl-3-[4-[1,3-dioxo-6-(3-piperidin-1-ylpropylamino)-4H-isoquinolin-2-yl]phenyl]urea |
| SMILES | Cc1sc(SNC(=O)Nc2ccc(N3C(=O)Cc4cc(NCCCN5CCCCC5)ccc4C3=O)cc2)cc1Cl |
| InChI | InChI=1S/C29H32ClN5O3S2/c1-19-25(30)18-27(39-19)40-33-29(38)32-21-6-9-23(10-7-21)35-26(36)17-20-16-22(8-11-24(20)28(35)37)31-12-5-15-34-13-3-2-4-14-34/h6-11,16,18,31H,2-5,12-15,17H2,1H3,(H2,32,33,38) |
| InChIKey | UJQPRGJJSOYKAO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.19 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|