C22H20ClN3O3S2 — CID 142210525
1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[4-(6-methyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea (PubChem CID 142210525) has the molecular formula C22H20ClN3O3S2 and a molecular weight of 474.01 g/mol. Its IUPAC name is 1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[4-(6-methyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea.
| Compound Name | 1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[4-(6-methyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 142210525 |
| Molecular Formula | C22H20ClN3O3S2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[4-(6-methyl-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
| SMILES | C=C(Cl)S/C(=C\C)SNC(=O)Nc1ccc(N2C(=O)Cc3cc(C)ccc3C2=O)cc1 |
| InChI | InChI=1S/C22H20ClN3O3S2/c1-4-20(30-14(3)23)31-25-22(29)24-16-6-8-17(9-7-16)26-19(27)12-15-11-13(2)5-10-18(15)21(26)28/h4-11H,3,12H2,1-2H3,(H2,24,25,29)/b20-4+ |
| InChIKey | CTUOFASSGQZPAO-LRNAUUFOSA-N |
| XLogP | 5.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|