C20H13ClFN3O4S2 — CID 142210175
1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea (PubChem CID 142210175) has the molecular formula C20H13ClFN3O4S2 and a molecular weight of 477.93 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 142210175 |
| Molecular Formula | C20H13ClFN3O4S2 |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(N2C(=O)Cc3ccc(F)cc3C2=O)cc1)NS(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H13ClFN3O4S2/c21-16-7-8-18(30-16)31(29)24-20(28)23-13-3-5-14(6-4-13)25-17(26)9-11-1-2-12(22)10-15(11)19(25)27/h1-8,10H,9H2,(H2,23,24,28) |
| InChIKey | IVWXCRCIBVDTOL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|