C19H12ClFN4O3S2 — CID 142210432
1-(5-chlorothiophen-2-yl)sulfinyl-3-[3-fluoro-4-(4-oxo-1H-cinnolin-3-yl)phenyl]urea (PubChem CID 142210432) has the molecular formula C19H12ClFN4O3S2 and a molecular weight of 462.92 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfinyl-3-[3-fluoro-4-(4-oxo-1H-cinnolin-3-yl)phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfinyl-3-[3-fluoro-4-(4-oxo-1H-cinnolin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 142210432 |
| Molecular Formula | C19H12ClFN4O3S2 |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfinyl-3-[3-fluoro-4-(4-oxo-1H-cinnolin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2n[nH]c3ccccc3c2=O)c(F)c1)NS(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H12ClFN4O3S2/c20-15-7-8-16(29-15)30(28)25-19(27)22-10-5-6-11(13(21)9-10)17-18(26)12-3-1-2-4-14(12)23-24-17/h1-9H,(H,23,26)(H2,22,25,27) |
| InChIKey | IPMPNMJCJBTFBT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |