C23H21ClFN3O3S2 — CID 142210283
1-[1-[(E)-1-chlorobut-1-enyl]sulfanylethenylsulfanyl]-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)-3-methylphenyl]urea (PubChem CID 142210283) has the molecular formula C23H21ClFN3O3S2 and a molecular weight of 506.02 g/mol. Its IUPAC name is 1-[1-[(E)-1-chlorobut-1-enyl]sulfanylethenylsulfanyl]-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)-3-methylphenyl]urea.
| Compound Name | 1-[1-[(E)-1-chlorobut-1-enyl]sulfanylethenylsulfanyl]-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)-3-methylphenyl]urea |
|---|---|
| PubChem CID | 142210283 |
| Molecular Formula | C23H21ClFN3O3S2 |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 1-[1-[(E)-1-chlorobut-1-enyl]sulfanylethenylsulfanyl]-3-[4-(7-fluoro-1,3-dioxo-4H-isoquinolin-2-yl)-3-methylphenyl]urea |
| SMILES | C=C(SNC(=O)Nc1ccc(N2C(=O)Cc3ccc(F)cc3C2=O)c(C)c1)S/C(Cl)=C\CC |
| InChI | InChI=1S/C23H21ClFN3O3S2/c1-4-5-20(24)32-14(3)33-27-23(31)26-17-8-9-19(13(2)10-17)28-21(29)11-15-6-7-16(25)12-18(15)22(28)30/h5-10,12H,3-4,11H2,1-2H3,(H2,26,27,31)/b20-5- |
| InChIKey | WGHPAMHFCCRERJ-SDPNRITHSA-N |
| XLogP | 6.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|