C28H31N5O6S2 — CID 71072466
1-(5-methylthiophen-2-yl)sulfonyl-3-[4-[6-(3-morpholin-4-ylpropylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]urea (PubChem CID 71072466) has the molecular formula C28H31N5O6S2 and a molecular weight of 597.72 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)sulfonyl-3-[4-[6-(3-morpholin-4-ylpropylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]urea.
| Compound Name | 1-(5-methylthiophen-2-yl)sulfonyl-3-[4-[6-(3-morpholin-4-ylpropylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 71072466 |
| Molecular Formula | C28H31N5O6S2 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)sulfonyl-3-[4-[6-(3-morpholin-4-ylpropylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(N3C(=O)Cc4cc(NCCCN5CCOCC5)ccc4C3=O)cc2)s1 |
| InChI | InChI=1S/C28H31N5O6S2/c1-19-3-10-26(40-19)41(37,38)31-28(36)30-21-4-7-23(8-5-21)33-25(34)18-20-17-22(6-9-24(20)27(33)35)29-11-2-12-32-13-15-39-16-14-32/h3-10,17,29H,2,11-16,18H2,1H3,(H2,30,31,36) |
| InChIKey | PETAJXFOOJLKIX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|