C23H18ClFN4O7S2 — CID 20800244
methyl 2-[4-[(5-chlorothiophen-2-yl)sulfonylcarbamoylamino]-2-fluorophenyl]-6-(methylamino)-1,3-dioxo-4H-isoquinoline-4-carboxylate (PubChem CID 20800244) has the molecular formula C23H18ClFN4O7S2 and a molecular weight of 581.00 g/mol. Its IUPAC name is methyl 2-[4-[(5-chlorothiophen-2-yl)sulfonylcarbamoylamino]-2-fluorophenyl]-6-(methylamino)-1,3-dioxo-4H-isoquinoline-4-carboxylate.
| Compound Name | methyl 2-[4-[(5-chlorothiophen-2-yl)sulfonylcarbamoylamino]-2-fluorophenyl]-6-(methylamino)-1,3-dioxo-4H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 20800244 |
| Molecular Formula | C23H18ClFN4O7S2 |
| Molecular Weight | 581.00 g/mol |
| Exact Mass | 580.03 |
| IUPAC Name | methyl 2-[4-[(5-chlorothiophen-2-yl)sulfonylcarbamoylamino]-2-fluorophenyl]-6-(methylamino)-1,3-dioxo-4H-isoquinoline-4-carboxylate |
| SMILES | CNc1ccc2c(c1)C(C(=O)OC)C(=O)N(c1ccc(NC(=O)NS(=O)(=O)c3ccc(Cl)s3)cc1F)C2=O |
| InChI | InChI=1S/C23H18ClFN4O7S2/c1-26-11-3-5-13-14(9-11)19(22(32)36-2)21(31)29(20(13)30)16-6-4-12(10-15(16)25)27-23(33)28-38(34,35)18-8-7-17(24)37-18/h3-10,19,26H,1-2H3,(H2,27,28,33) |
| InChIKey | KJLBACLMFVHUIW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.00 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|