C24H17Cl2N3O7S3 — CID 159259075
8-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-3-methyl-1,1-dioxo-4,6-dihydropyrido[4,3-g][1,2,4]benzothiadiazine-7,9-dione (PubChem CID 159259075) has the molecular formula C24H17Cl2N3O7S3 and a molecular weight of 626.52 g/mol. Its IUPAC name is 8-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-3-methyl-1,1-dioxo-4,6-dihydropyrido[4,3-g][1,2,4]benzothiadiazine-7,9-dione.
| Compound Name | 8-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-3-methyl-1,1-dioxo-4,6-dihydropyrido[4,3-g][1,2,4]benzothiadiazine-7,9-dione |
|---|---|
| PubChem CID | 159259075 |
| Molecular Formula | C24H17Cl2N3O7S3 |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 624.96 |
| IUPAC Name | 8-[2-chloro-4-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]phenyl]-3-methyl-1,1-dioxo-4,6-dihydropyrido[4,3-g][1,2,4]benzothiadiazine-7,9-dione |
| SMILES | CC1=NS(=O)(=O)c2cc3c(cc2N1)CC(=O)N(c1ccc(CC(=O)CS(=O)(=O)c2ccc(Cl)s2)cc1Cl)C3=O |
| InChI | InChI=1S/C24H17Cl2N3O7S3/c1-12-27-18-8-14-9-22(31)29(24(32)16(14)10-20(18)39(35,36)28-12)19-3-2-13(7-17(19)25)6-15(30)11-38(33,34)23-5-4-21(26)37-23/h2-5,7-8,10H,6,9,11H2,1H3,(H,27,28) |
| InChIKey | OIRJITKNZBLBIL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|