C22H17FN2O5S2 — CID 159051733
2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-methyl-4H-isoquinoline-1,3-dione (PubChem CID 159051733) has the molecular formula C22H17FN2O5S2 and a molecular weight of 472.52 g/mol. Its IUPAC name is 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-methyl-4H-isoquinoline-1,3-dione.
| Compound Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-methyl-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 159051733 |
| Molecular Formula | C22H17FN2O5S2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-methyl-4H-isoquinoline-1,3-dione |
| SMILES | Cc1ccc2c(c1)CC(=O)N(c1ccc(CC(=O)CS(=O)(=O)c3ccc(F)s3)cn1)C2=O |
| InChI | InChI=1S/C22H17FN2O5S2/c1-13-2-4-17-15(8-13)10-20(27)25(22(17)28)19-6-3-14(11-24-19)9-16(26)12-32(29,30)21-7-5-18(23)31-21/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | QJVCYWWRSWTXSM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|