C25H22FN3O5S2 — CID 161215823
2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-pyrrolidin-1-yl-4H-isoquinoline-1,3-dione (PubChem CID 161215823) has the molecular formula C25H22FN3O5S2 and a molecular weight of 527.60 g/mol. Its IUPAC name is 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-pyrrolidin-1-yl-4H-isoquinoline-1,3-dione.
| Compound Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-pyrrolidin-1-yl-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 161215823 |
| Molecular Formula | C25H22FN3O5S2 |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-pyrrolidin-1-yl-4H-isoquinoline-1,3-dione |
| SMILES | O=C(Cc1ccc(N2C(=O)Cc3cc(N4CCCC4)ccc3C2=O)nc1)CS(=O)(=O)c1ccc(F)s1 |
| InChI | InChI=1S/C25H22FN3O5S2/c26-21-6-8-24(35-21)36(33,34)15-19(30)11-16-3-7-22(27-14-16)29-23(31)13-17-12-18(28-9-1-2-10-28)4-5-20(17)25(29)32/h3-8,12,14H,1-2,9-11,13,15H2 |
| InChIKey | HKWCZKMJOYKTOU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|