C23H18ClN5O6S3 — CID 159306936
8-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-3,7-dimethyl-1,1-dioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-9-one (PubChem CID 159306936) has the molecular formula C23H18ClN5O6S3 and a molecular weight of 592.08 g/mol. Its IUPAC name is 8-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-3,7-dimethyl-1,1-dioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-9-one.
| Compound Name | 8-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-3,7-dimethyl-1,1-dioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-9-one |
|---|---|
| PubChem CID | 159306936 |
| Molecular Formula | C23H18ClN5O6S3 |
| Molecular Weight | 592.08 g/mol |
| Exact Mass | 591.01 |
| IUPAC Name | 8-[5-[3-(5-chlorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-3,7-dimethyl-1,1-dioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-9-one |
| SMILES | CC1=NS(=O)(=O)c2cc3c(=O)n(-c4ccc(CC(=O)CS(=O)(=O)c5ccc(Cl)s5)cn4)c(C)nc3cc2N1 |
| InChI | InChI=1S/C23H18ClN5O6S3/c1-12-26-18-9-17-16(8-19(18)38(34,35)28-12)23(31)29(13(2)27-17)21-5-3-14(10-25-21)7-15(30)11-37(32,33)22-6-4-20(24)36-22/h3-6,8-10H,7,11H2,1-2H3,(H,26,28) |
| InChIKey | LHVUZVQWIXSCLR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.08 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |