C22H19N7O6S3 — CID 70956564
1-[6-(3,7-dimethyl-1,1,9-trioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-8-yl)-3-pyridinyl]-3-(5-methylthiophen-2-yl)sulfonylurea (PubChem CID 70956564) has the molecular formula C22H19N7O6S3 and a molecular weight of 573.64 g/mol. Its IUPAC name is 1-[6-(3,7-dimethyl-1,1,9-trioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-8-yl)-3-pyridinyl]-3-(5-methylthiophen-2-yl)sulfonylurea.
| Compound Name | 1-[6-(3,7-dimethyl-1,1,9-trioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-8-yl)-3-pyridinyl]-3-(5-methylthiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 70956564 |
| Molecular Formula | C22H19N7O6S3 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.06 |
| IUPAC Name | 1-[6-(3,7-dimethyl-1,1,9-trioxo-4H-pyrimido[4,5-g][1,2,4]benzothiadiazin-8-yl)-3-pyridinyl]-3-(5-methylthiophen-2-yl)sulfonylurea |
| SMILES | CC1=NS(=O)(=O)c2cc3c(=O)n(-c4ccc(NC(=O)NS(=O)(=O)c5ccc(C)s5)cn4)c(C)nc3cc2N1 |
| InChI | InChI=1S/C22H19N7O6S3/c1-11-4-7-20(36-11)38(34,35)28-22(31)26-14-5-6-19(23-10-14)29-13(3)25-16-9-17-18(8-15(16)21(29)30)37(32,33)27-12(2)24-17/h4-10H,1-3H3,(H,24,27)(H2,26,28,31) |
| InChIKey | RFKFNQQEIQCCHI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 181.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |