About ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate
ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate (PubChem CID 10198231) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate |
| PubChem CID | 10198231 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate |
| SMILES | CCOC(=O)Cn1c(C)c[nH]c(=O)c1=O |
| InChI | InChI=1S/C9H12N2O4/c1-3-15-7(12)5-11-6(2)4-10-8(13)9(11)14/h4H,3,5H2,1-2H3,(H,10,13) |
| InChIKey | SYJKPFGJXSVTLC-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate?
The IUPAC name of ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate (CID 10198231) is ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate.
What is the SMILES notation for ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate?
The canonical SMILES for ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate is CCOC(=O)Cn1c(C)c[nH]c(=O)c1=O.
What is the InChIKey of ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate?
The InChIKey is SYJKPFGJXSVTLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-3-15-7(12)5-11-6(2)4-10-8(13)9(11)14/h4H,3,5H2,1-2H3,(H,10,13).
What are the key properties of ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate?
ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate has a molecular weight of 212.20 g/mol, XLogP of -0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-methyl-2,3-dioxo-1H-pyrazin-4-yl)acetate is sourced from PubChem (CID 10198231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).