C9H10N2O5 — CID 11053340
ethyl 2-(5-formyl-2,3-dioxo-1H-pyrazin-4-yl)acetate (PubChem CID 11053340) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is ethyl 2-(5-formyl-2,3-dioxo-1H-pyrazin-4-yl)acetate.
| Compound Name | ethyl 2-(5-formyl-2,3-dioxo-1H-pyrazin-4-yl)acetate |
|---|---|
| PubChem CID | 11053340 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | ethyl 2-(5-formyl-2,3-dioxo-1H-pyrazin-4-yl)acetate |
| SMILES | CCOC(=O)Cn1c(C=O)c[nH]c(=O)c1=O |
| InChI | InChI=1S/C9H10N2O5/c1-2-16-7(13)4-11-6(5-12)3-10-8(14)9(11)15/h3,5H,2,4H2,1H3,(H,10,14) |
| InChIKey | NKWKDZHNIWEITB-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|