About ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride
ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride (PubChem CID 158383302) has the molecular formula C9H11Cl4N2O4P
and a molecular weight of 383.98 g/mol. Its IUPAC name is ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride.
Molecular Properties
| Compound Name | ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride |
| PubChem CID | 158383302 |
| Molecular Formula | C9H11Cl4N2O4P |
| Molecular Weight | 383.98 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride |
| SMILES | CCOC(=O)Cn1c(C)cnc(Cl)c1=O.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H11ClN2O3.Cl3OP/c1-3-15-7(13)5-12-6(2)4-11-8(10)9(12)14;1-5(2,3)4/h4H,3,5H2,1-2H3; |
| InChIKey | GWBFEAZTWUIMSK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.98 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride?
The IUPAC name of ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride (CID 158383302) is ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride.
What is the SMILES notation for ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride?
The canonical SMILES for ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride is CCOC(=O)Cn1c(C)cnc(Cl)c1=O.O=P(Cl)(Cl)Cl.
What is the InChIKey of ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride?
The InChIKey is GWBFEAZTWUIMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O3.Cl3OP/c1-3-15-7(13)5-12-6(2)4-11-8(10)9(12)14;1-5(2,3)4/h4H,3,5H2,1-2H3;.
What are the key properties of ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride?
ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride has a molecular weight of 383.98 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-chloro-6-methyl-2-oxopyrazin-1-yl)acetate;phosphoryl trichloride is sourced from PubChem (CID 158383302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).