C12H10Cl2N2O3 — CID 19808448
ethyl 2-(6,8-dichloro-2-oxoquinoxalin-1-yl)acetate (PubChem CID 19808448) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is ethyl 2-(6,8-dichloro-2-oxoquinoxalin-1-yl)acetate.
| Compound Name | ethyl 2-(6,8-dichloro-2-oxoquinoxalin-1-yl)acetate |
|---|---|
| PubChem CID | 19808448 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | ethyl 2-(6,8-dichloro-2-oxoquinoxalin-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(=O)cnc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C12H10Cl2N2O3/c1-2-19-11(18)6-16-10(17)5-15-9-4-7(13)3-8(14)12(9)16/h3-5H,2,6H2,1H3 |
| InChIKey | WMCGDKLQARTVJW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |