C17H21ClN4O3 — CID 58619021
ethyl 2-[3-[[(2S)-1-amino-3-phenylpropan-2-yl]amino]-6-chloro-2-oxopyrazin-1-yl]acetate (PubChem CID 58619021) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is ethyl 2-[3-[[(2S)-1-amino-3-phenylpropan-2-yl]amino]-6-chloro-2-oxopyrazin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[[(2S)-1-amino-3-phenylpropan-2-yl]amino]-6-chloro-2-oxopyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 58619021 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl 2-[3-[[(2S)-1-amino-3-phenylpropan-2-yl]amino]-6-chloro-2-oxopyrazin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(Cl)cnc(N[C@H](CN)Cc2ccccc2)c1=O |
| InChI | InChI=1S/C17H21ClN4O3/c1-2-25-15(23)11-22-14(18)10-20-16(17(22)24)21-13(9-19)8-12-6-4-3-5-7-12/h3-7,10,13H,2,8-9,11,19H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | YFLDHTCOIKMHGH-ZDUSSCGKSA-N |
| XLogP | 1.44 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |