C25H29ClN4O3 — CID 18470849
benzyl 2-[3-chloro-5-[[1-(dimethylamino)-2-phenylpropyl]amino]-2-methyl-6-oxopyrazin-1-yl]acetate (PubChem CID 18470849) has the molecular formula C25H29ClN4O3 and a molecular weight of 468.99 g/mol. Its IUPAC name is benzyl 2-[3-chloro-5-[[1-(dimethylamino)-2-phenylpropyl]amino]-2-methyl-6-oxopyrazin-1-yl]acetate.
| Compound Name | benzyl 2-[3-chloro-5-[[1-(dimethylamino)-2-phenylpropyl]amino]-2-methyl-6-oxopyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 18470849 |
| Molecular Formula | C25H29ClN4O3 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | benzyl 2-[3-chloro-5-[[1-(dimethylamino)-2-phenylpropyl]amino]-2-methyl-6-oxopyrazin-1-yl]acetate |
| SMILES | Cc1c(Cl)nc(NC(C(C)c2ccccc2)N(C)C)c(=O)n1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29ClN4O3/c1-17(20-13-9-6-10-14-20)24(29(3)4)28-23-25(32)30(18(2)22(26)27-23)15-21(31)33-16-19-11-7-5-8-12-19/h5-14,17,24H,15-16H2,1-4H3,(H,27,28) |
| InChIKey | LWRIDDVOCLNEIL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|