C19H14Cl2N2O4 — CID 11079983
benzyl 2-[3,5-dichloro-2-(3-hydroxyphenyl)-6-oxopyrazin-1-yl]acetate (PubChem CID 11079983) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is benzyl 2-[3,5-dichloro-2-(3-hydroxyphenyl)-6-oxopyrazin-1-yl]acetate.
| Compound Name | benzyl 2-[3,5-dichloro-2-(3-hydroxyphenyl)-6-oxopyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 11079983 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | benzyl 2-[3,5-dichloro-2-(3-hydroxyphenyl)-6-oxopyrazin-1-yl]acetate |
| SMILES | O=C(Cn1c(-c2cccc(O)c2)c(Cl)nc(Cl)c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N2O4/c20-17-16(13-7-4-8-14(24)9-13)23(19(26)18(21)22-17)10-15(25)27-11-12-5-2-1-3-6-12/h1-9,24H,10-11H2 |
| InChIKey | IBSREWXKEWPEAE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |