About benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate
benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate (PubChem CID 10983695) has the molecular formula C20H17Cl2N3O5S
and a molecular weight of 482.35 g/mol. Its IUPAC name is benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate |
| PubChem CID | 10983695 |
| Molecular Formula | C20H17Cl2N3O5S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate |
| SMILES | CS(=O)(=O)Nc1cccc(-c2c(Cl)nc(Cl)c(=O)n2CC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H17Cl2N3O5S/c1-31(28,29)24-15-9-5-8-14(10-15)17-18(21)23-19(22)20(27)25(17)11-16(26)30-12-13-6-3-2-4-7-13/h2-10,24H,11-12H2,1H3 |
| InChIKey | KTLQFBCPUFLZQP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate?
The IUPAC name of benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate (CID 10983695) is benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate.
What is the SMILES notation for benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate?
The canonical SMILES for benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate is CS(=O)(=O)Nc1cccc(-c2c(Cl)nc(Cl)c(=O)n2CC(=O)OCc2ccccc2)c1.
What is the InChIKey of benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate?
The InChIKey is KTLQFBCPUFLZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Cl2N3O5S/c1-31(28,29)24-15-9-5-8-14(10-15)17-18(21)23-19(22)20(27)25(17)11-16(26)30-12-13-6-3-2-4-7-13/h2-10,24H,11-12H2,1H3.
What are the key properties of benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate?
benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate has a molecular weight of 482.35 g/mol, XLogP of 3.33, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[3,5-dichloro-2-[3-(methanesulfonamido)phenyl]-6-oxopyrazin-1-yl]acetate is sourced from PubChem (CID 10983695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).