C26H22ClNO3S — CID 11754161
N-[3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]phenyl]methanesulfonamide (PubChem CID 11754161) has the molecular formula C26H22ClNO3S and a molecular weight of 463.99 g/mol. Its IUPAC name is N-[3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 11754161 |
| Molecular Formula | C26H22ClNO3S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-[3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2ccccc2-c2cc(Cl)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H22ClNO3S/c1-32(29,30)28-22-11-7-10-20(16-22)23-12-5-6-13-24(23)25-17-21(27)14-15-26(25)31-18-19-8-3-2-4-9-19/h2-17,28H,18H2,1H3 |
| InChIKey | WUTKHXWZOILTJG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |