C28H27ClFNO5S — CID 90849175
ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(methanesulfonamido)benzoate (PubChem CID 90849175) has the molecular formula C28H27ClFNO5S and a molecular weight of 544.04 g/mol. Its IUPAC name is ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(methanesulfonamido)benzoate.
| Compound Name | ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 90849175 |
| Molecular Formula | C28H27ClFNO5S |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(methanesulfonamido)benzoate |
| SMILES | CCOC(=O)c1cc(NS(C)(=O)=O)cc(C2=C(c3cc(Cl)ccc3OCc3ccc(F)cc3)CCC2)c1 |
| InChI | InChI=1S/C28H27ClFNO5S/c1-3-35-28(32)20-13-19(14-23(15-20)31-37(2,33)34)24-5-4-6-25(24)26-16-21(29)9-12-27(26)36-17-18-7-10-22(30)11-8-18/h7-16,31H,3-6,17H2,1-2H3 |
| InChIKey | ZJXCCUFIDGOZFB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|