C31H29ClFNO4 — CID 90852947
ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 90852947) has the molecular formula C31H29ClFNO4 and a molecular weight of 534.03 g/mol. Its IUPAC name is ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 90852947 |
| Molecular Formula | C31H29ClFNO4 |
| Molecular Weight | 534.03 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | ethyl 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]-5-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc(C2=C(c3cc(Cl)ccc3OCc3ccc(F)cc3)CCC2)cc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C31H29ClFNO4/c1-2-37-31(36)22-15-21(16-25(17-22)34-14-4-7-30(34)35)26-5-3-6-27(26)28-18-23(32)10-13-29(28)38-19-20-8-11-24(33)12-9-20/h8-13,15-18H,2-7,14,19H2,1H3 |
| InChIKey | DLENMPRQLNXFKE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.03 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|