C29H28FNO4 — CID 10238772
3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopenten-1-yl]-5-(propanoylamino)benzoic acid (PubChem CID 10238772) has the molecular formula C29H28FNO4 and a molecular weight of 473.54 g/mol. Its IUPAC name is 3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopenten-1-yl]-5-(propanoylamino)benzoic acid.
| Compound Name | 3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopenten-1-yl]-5-(propanoylamino)benzoic acid |
|---|---|
| PubChem CID | 10238772 |
| Molecular Formula | C29H28FNO4 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]cyclopenten-1-yl]-5-(propanoylamino)benzoic acid |
| SMILES | CCC(=O)Nc1cc(C(=O)O)cc(C2=C(c3cc(C)ccc3OCc3ccc(F)cc3)CCC2)c1 |
| InChI | InChI=1S/C29H28FNO4/c1-3-28(32)31-23-15-20(14-21(16-23)29(33)34)24-5-4-6-25(24)26-13-18(2)7-12-27(26)35-17-19-8-10-22(30)11-9-19/h7-16H,3-6,17H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | PRCCFAGOKDOFFR-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|