C31H26F3NO4 — CID 10030034
3-(butanoylamino)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]phenyl]benzoic acid (PubChem CID 10030034) has the molecular formula C31H26F3NO4 and a molecular weight of 533.55 g/mol. Its IUPAC name is 3-(butanoylamino)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]phenyl]benzoic acid.
| Compound Name | 3-(butanoylamino)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 10030034 |
| Molecular Formula | C31H26F3NO4 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 3-(butanoylamino)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]phenyl]benzoic acid |
| SMILES | CCCC(=O)Nc1cc(C(=O)O)cc(-c2ccccc2-c2cc(C(F)(F)F)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H26F3NO4/c1-2-8-29(36)35-24-16-21(15-22(17-24)30(37)38)25-11-6-7-12-26(25)27-18-23(31(32,33)34)13-14-28(27)39-19-20-9-4-3-5-10-20/h3-7,9-18H,2,8,19H2,1H3,(H,35,36)(H,37,38) |
| InChIKey | KSEZCBXKFFQMHR-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |