C21H14ClF3O3 — CID 155154013
3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-5-phenylbenzoic acid (PubChem CID 155154013) has the molecular formula C21H14ClF3O3 and a molecular weight of 406.79 g/mol. Its IUPAC name is 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-5-phenylbenzoic acid.
| Compound Name | 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-5-phenylbenzoic acid |
|---|---|
| PubChem CID | 155154013 |
| Molecular Formula | C21H14ClF3O3 |
| Molecular Weight | 406.79 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-5-phenylbenzoic acid |
| SMILES | O=C(O)c1cc(COc2ccc(C(F)(F)F)cc2Cl)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H14ClF3O3/c22-18-11-17(21(23,24)25)6-7-19(18)28-12-13-8-15(10-16(9-13)20(26)27)14-4-2-1-3-5-14/h1-11H,12H2,(H,26,27) |
| InChIKey | WYSUPNWATDOQCJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |